- Valdecoxib IMpurity B
-
- $1.00 / 1KG
-
2019-07-06
- CAS:1373038-60-8
- Min. Order: 1G
- Purity: 99%
- Supply Ability: 100KG
|
| | Valdecoxib IMpurity B Basic information |
| Product Name: | Valdecoxib IMpurity B | | Synonyms: | Valdecoxib DiMer,Valdecoxib IMpurity B;4-(5-methyl-3-phenylisoxazol-4-yl)-N-((4-(5-methyl-3-phenylisoxazol-4-yl)phenyl)sulfonyl)benzenesulfonamide;N-[4-(5-Methyl-3-phenyl-4-isoxazolyl)benzenesulfonyl]-4-(5-Methyl-3-phenyl-4-isoxazolyl)benzenesulfonaMide;Valdecoxib DiMer;Valdecoxib IMpurity B;Valdecoxib IMpurity-B(valdecoxib DiMer);BenzenesulfonaMide, 4-(5-Methyl-3-phenyl-4-isoxazolyl)-N-[[4-(5-Methyl-3-phenyl-4-isoxazolyl)phenyl]sulfonyl]-;4-(5-Methyl-3-phenyl-4-isoxazolyl)-N-[[4-(5-methyl-3-phenyl-4-isoxazolyl)phenyl]sulfonyl]benzenesulfonamide | | CAS: | 1373038-60-8 | | MF: | C32H25N3O6S2 | | MW: | 611.69 | | EINECS: | | | Product Categories: | Amines;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 1373038-60-8.mol |  |
| | Valdecoxib IMpurity B Chemical Properties |
| Melting point | >271°C (dec.) | | Boiling point | 732.7±70.0 °C(Predicted) | | density | 1.343±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | -4.23±0.40(Predicted) | | form | Solid | | color | White to Off-White | | InChIKey | FDUYPVXQEAKTGG-UHFFFAOYSA-N | | SMILES | C1(S(NS(C2=CC=C(C3=C(C)ON=C3C3=CC=CC=C3)C=C2)(=O)=O)(=O)=O)=CC=C(C2=C(C)ON=C2C2=CC=CC=C2)C=C1 |
| | Valdecoxib IMpurity B Usage And Synthesis |
| Uses | Valdecoxib Dimer is a dimeric impurity of the cyclooxygenase-2 inhibitor, Valdecoxib (V090000). |
| | Valdecoxib IMpurity B Preparation Products And Raw materials |
|