|
|
| | 4,4'-(1,2-diethylethylene)bis(anisole) Basic information |
| Product Name: | 4,4'-(1,2-diethylethylene)bis(anisole) | | Synonyms: | 4,4'-(1,2-diethylethylene)bis(anisole);Benzene, 1,1-(1,2-diethyl-1,2-ethanediyl)bis4-methoxy-;1,1'-Hexane-3,4-diylbis(4-methoxybenzene);Inchi=1/C20H26o2/C1-5-19(15-7-11-17(21-3)12-8-15)20(6-2)16-9-13-18(22-4)14-10-16/H7-14,19-20H,5-6H2,1-4h | | CAS: | 130-78-9 | | MF: | C20H26O2 | | MW: | 298.42 | | EINECS: | 204-993-3 | | Product Categories: | | | Mol File: | 130-78-9.mol |  |
| | 4,4'-(1,2-diethylethylene)bis(anisole) Chemical Properties |
| Melting point | 146 °C | | Boiling point | 175-185 °C(Press: 5 Torr) | | density | 0.999±0.06 g/cm3(Predicted) | | solubility | soluble in Chloroform | | form | Liquid | | color | Pale Yellow |
| | 4,4'-(1,2-diethylethylene)bis(anisole) Usage And Synthesis |
| Uses | Hexestrol-d4 Dimethyl Ether is an intermediate in the synthesis of Hexestrol-d4 (H295303). Estrogen; antineoplastic (hormonal). |
| | 4,4'-(1,2-diethylethylene)bis(anisole) Preparation Products And Raw materials |
|