|
|
| | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid Basic information |
| Product Name: | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid | | Synonyms: | 4-CHLORO-3-ETHYL-1-METHYL-1H-PYRAZOLE-5-CARBOXYLIC ACID;1H-Pyrazole-5-carboxylic acid, 4-chloro-3-ethyl-1-Methyl-;4-CHLORO-3-ETHYL-1-METHYL PYRAZOLE-5-CARBOXYLIC ACID;4-chloro-5-ethyl-2-methyl-3-pyrazolecarboxylic acid;4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylicaci;4-chloro-3-Ethyl-1-methyl-1H-Pyrazole-5- carboxylic | | CAS: | 127892-62-0 | | MF: | C7H9ClN2O2 | | MW: | 188.61 | | EINECS: | | | Product Categories: | Heterocycle | | Mol File: | 127892-62-0.mol |  |
| | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid Chemical Properties |
| Melting point | 164 °C | | Boiling point | 339.5±42.0 °C(Predicted) | | density | 1.40±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | 1.90±0.38(Predicted) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C7H9ClN2O2/c1-3-4-5(8)6(7(11)12)10(2)9-4/h3H2,1-2H3,(H,11,12) | | InChIKey | NXAIFVHVBHMNJS-UHFFFAOYSA-N | | SMILES | N1(C)C(C(O)=O)=C(Cl)C(CC)=N1 |
| | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid Usage And Synthesis |
| Uses | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-formic Acid is a useful reagent for the synthesis of anti-microbial compounds. |
| | 4-Chloro-3-ethyl-1-methyl-1H-pyrazole-5-carboxylic acid Preparation Products And Raw materials |
|