|
|
| | bis(2-methoxyphenyl)-oxophosphanium Basic information |
| Product Name: | bis(2-methoxyphenyl)-oxophosphanium | | Synonyms: | bis(2-methoxyphenyl)-oxophosphanium;Bisphosphine oxide;Phosphine oxide, bis(2-methoxyphenyl)-;Bis(2-methoxyphenyl)phosphine oxide;Bis-(0-methoxyphenyl)-phosphine oxide;- Bis(2-methoxyphenyl)phosphine oxide | | CAS: | 71360-04-8 | | MF: | C14H15O3P | | MW: | 262.24 | | EINECS: | | | Product Categories: | | | Mol File: | 71360-04-8.mol |  |
| | bis(2-methoxyphenyl)-oxophosphanium Chemical Properties |
| Melting point | 135-136 °C | | Boiling point | 417.8±55.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C14H15O3P/c1-16-11-7-3-5-9-13(11)18(15)14-10-6-4-8-12(14)17-2/h3-10,18H,1-2H3 | | InChIKey | WOVYHPRWFRQYII-UHFFFAOYSA-N | | SMILES | P(=O)(C1=CC=CC=C1OC)C1=CC=CC=C1OC |
| | bis(2-methoxyphenyl)-oxophosphanium Usage And Synthesis |
| | bis(2-methoxyphenyl)-oxophosphanium Preparation Products And Raw materials |
|