|
|
| | p-(Hexafluoro-2-hydroxypropyl)styrene Basic information |
| Product Name: | p-(Hexafluoro-2-hydroxypropyl)styrene | | Synonyms: | 4-(2,2,2-Trifluoro-1-hydroxy-1-trifluoromethylethyl)styrene;alpha,alpha-Bis(trifluoromethyl)-4-vinylbenzyl alcohol;p-(Hexafluoro-2-hydroxypropyl)styrene;Hexafluoro-2-(4-vinylphenyl)propan-2-ol;2-(4-ethenylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol;4-Ethenyl-α,α-bis(trifluoromethyl)benzenemethanol;Benzenemethanol, 4-ethenyl-α,α-bis(trifluoromethyl)-;α,α-Bis(trifluoromethyl)-4-vinylbenzyl alcoho | | CAS: | 2386-82-5 | | MF: | C11H8F6O | | MW: | 270.17 | | EINECS: | | | Product Categories: | | | Mol File: | 2386-82-5.mol |  |
| | p-(Hexafluoro-2-hydroxypropyl)styrene Chemical Properties |
| Boiling point | 74～75℃/3mm | | density | 1.379±0.06 g/cm3(Predicted) | | pka | 9.24±0.15(Predicted) | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C11H8F6O/c1-2-7-3-5-8(6-4-7)9(18,10(12,13)14)11(15,16)17/h2-6,18H,1H2 | | InChIKey | RHDPTOIUYREFCO-UHFFFAOYSA-N | | SMILES | C(C1C=CC(C=C)=CC=1)(O)(C(F)(F)F)C(F)(F)F |
| | p-(Hexafluoro-2-hydroxypropyl)styrene Usage And Synthesis |
| Uses | 1,1,1,3,3,3-Hexafluoro-2-(4-vinylphenyl)-propan-2-ol can be used to manufacture radiation-sensitive resin components, semiconductor devices, display devices, and hardened film. |
| | p-(Hexafluoro-2-hydroxypropyl)styrene Preparation Products And Raw materials |
|