|
| 2-Chloro-6-mercaptobenzoic acid Basic information |
Product Name: | 2-Chloro-6-mercaptobenzoic acid | Synonyms: | 2-Chloro-6-mercaptobenzoic acid;Benzoic acid, 2-chloro-6-Mercapto-;6-Chloro-2-mercaptobenzoic acid;2-Mercapto-6-Chloro Benzoic Acid | CAS: | 20324-51-0 | MF: | C7H5ClO2S | MW: | 188.63 | EINECS: | 1312995-182-4 | Product Categories: | | Mol File: | 20324-51-0.mol | |
| 2-Chloro-6-mercaptobenzoic acid Chemical Properties |
Boiling point | 323.2±27.0 °C(Predicted) | density | 1.490 | pka | 2.35±0.36(Predicted) | InChI | InChI=1S/C7H5ClO2S/c8-4-2-1-3-5(11)6(4)7(9)10/h1-3,11H,(H,9,10) | InChIKey | AQKPOJRMYFQSLX-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=C(S)C=CC=C1Cl |
| 2-Chloro-6-mercaptobenzoic acid Usage And Synthesis |
Uses | 2-??Chloro-??6-??mercaptobenzoic Acid is a useful research chemical used in the preparation and synthesis of acetophenone oxime esters of pyrithiobac as potential herbicides. |
| 2-Chloro-6-mercaptobenzoic acid Preparation Products And Raw materials |
|