|
|
| | N-Cyano-N-phenyl-p-toluenesulfonaMide Basic information |
| Product Name: | N-Cyano-N-phenyl-p-toluenesulfonaMide | | Synonyms: | N-Cyano-N-phenyl-p-toluenesulfonaMide;N-Cyano-N-phenyl-p-toluenesulphonamide;Benzenesulfonamide, N-cyano-4-methyl-N-phenyl-;N-Cyano-4-methyl-N-phenylbenzenesulfonamide;N-Cyano-N-phenyl-p-toluenesulfomide;N-cyano-4-methyl-N-phenylbenzene-1-sulfonamide | | CAS: | 55305-43-6 | | MF: | C14H12N2O2S | | MW: | 272.32 | | EINECS: | | | Product Categories: | | | Mol File: | 55305-43-6.mol |  |
| | N-Cyano-N-phenyl-p-toluenesulfonaMide Chemical Properties |
| Melting point | 85-87 °C | | Boiling point | 418.4±38.0 °C(Predicted) | | density | 1.317±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | -8.96±0.50(Predicted) | | color | White | | InChI | InChI=1S/C14H12N2O2S/c1-12-7-9-14(10-8-12)19(17,18)16(11-15)13-5-3-2-4-6-13/h2-10H,1H3 | | InChIKey | CIIFNSIDKZSDBR-UHFFFAOYSA-N | | SMILES | C1(S(N(C#N)C2=CC=CC=C2)(=O)=O)=CC=C(C)C=C1 |
| Safety Statements | 24/25 | | HS Code | 29350090 |
| | N-Cyano-N-phenyl-p-toluenesulfonaMide Usage And Synthesis |
| Uses | N-Cyano-N-phenyl-p-toluenesulfonamide is a useful research reactant for the synthesis of synthesis of 1,?2,?4-?triazol-?3-?imines through stepwise cycloaddition. |
| | N-Cyano-N-phenyl-p-toluenesulfonaMide Preparation Products And Raw materials |
|