| Company Name: |
Hunan Hui Bai Shi Biotechnology Co., Ltd.
|
| Tel: |
0731-85526065 13308475853 |
| Email: |
ivy@hnhbsj.com |
| Products Intro: |
Product Name:2-Deoxy-2-(acetylamino)-D-glucopyranose
CAS:72-87-7
Package:25g/280;1kg/4600
|
| Company Name: |
Wuhan Fortuna Chemical Co., Ltd
|
| Tel: |
027-027-59207852 13308628970 |
| Email: |
buy@fortunachem.com |
| Products Intro: |
Product Name: 2-Deoxy-2-(acetylamino)-D-glucopyranose
CAS:72-87-7
Purity:98% Package:5g
|
2-Deoxy-2-(acetylamino)-D-glucopyranose manufacturers
|
| | 2-Deoxy-2-(acetylamino)-D-glucopyranose Basic information |
| | 2-Deoxy-2-(acetylamino)-D-glucopyranose Chemical Properties |
| Boiling point | 595.4±50.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | pka | 12.04±0.70(Predicted) | | InChI | InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8?/m1/s1 | | InChIKey | OVRNDRQMDRJTHS-RTRLPJTCSA-N | | SMILES | OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(C)=O |
| | 2-Deoxy-2-(acetylamino)-D-glucopyranose Usage And Synthesis |
| Uses | A labelled derivative of D-Mannosamine (M167000). | | Definition | ChEBI: Chitin is an aminoglycan consisting of beta-(1->4)-linked N-acetyl-D-glucosamine residues. It has a role as a vulnerary, a human metabolite, a Saccharomyces cerevisiae metabolite and a mouse metabolite. It is an aminoglycan and a N-acylglucosamine. |
| | 2-Deoxy-2-(acetylamino)-D-glucopyranose Preparation Products And Raw materials |
|