- 1-DHEA
-
- $11.00 / 1kg
-
2024-05-11
- CAS:76822-24-7
- Min. Order: 0.10000000149011612kg
- Purity: 98%
- Supply Ability: 10 tons
- 1－DHEA
-
- $0.00 / 1kg
-
2024-04-12
- CAS:76822-24-7
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10T
|
| | 1-androstene-3b-ol,17-one Basic information |
| Product Name: | 1-androstene-3b-ol,17-one | | Synonyms: | 1-androstene-3b-ol,17-one;1-Androsterone Muscle Building 1-DHEA 98% CAS 76822-24-7 for Muscle Gain;1-Androsterone Muscle Building;1-DHEA, 1-ANDROSTENE-3B-OL,17-ONE;Androsta-1-ene-3b-ol,17-one;3-Hydroxyandrost-1-en-17-one;1-androstene-3b-ol,17-one / 1-DHEA;Androst-1-en-17-one, 3-hydroxy- | | CAS: | 76822-24-7 | | MF: | C19H28O2 | | MW: | 288.42 | | EINECS: | 200-533-0 | | Product Categories: | Amino Acids | | Mol File: | 76822-24-7.mol |  |
| | 1-androstene-3b-ol,17-one Chemical Properties |
| Boiling point | 416.2±45.0 °C(Predicted) | | density | 1.105±0.06 g/cm3(Predicted) | | pka | 14.32±0.60(Predicted) | | InChI | InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12-16,20H,3-6,8,10-11H2,1-2H3/t12?,13?,14-,15-,16-,18-,19-/m0/s1 | | InChIKey | DYMROBVXGSLPAY-OFLQVFCSSA-N | | SMILES | C1(O)CC2[C@](C)(C=C1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC2 |
| | 1-androstene-3b-ol,17-one Usage And Synthesis |
| Application | 1-androstene-3b-ol,17-one is a useful research chemical. |
| | 1-androstene-3b-ol,17-one Preparation Products And Raw materials |
|