| Identification | Back Directory | [Name]
Ademetionine 1,4-butanedisulfonate | [CAS]
1014692-62-6 | [Synonyms]
4-CHLORO-2,3-DIMETHYLTHIENO[2,3-B]PYRIDINE-5-CARBONITRILE
Thieno[2,3-b]pyridine-5-carbonitrile, 4-chloro-2,3-dimethyl- | [Molecular Formula]
C10H7ClN2S | [MOL File]
1014692-62-6.mol | [Molecular Weight]
222.69 |
| Chemical Properties | Back Directory | [Boiling point ]
389.3±37.0 °C(Predicted) | [density ]
1.38±0.1 g/cm3(Predicted) | [pka]
1.13±0.40(Predicted) | [InChI]
InChI=1S/C10H7ClN2S/c1-5-6(2)14-10-8(5)9(11)7(3-12)4-13-10/h4H,1-2H3 | [InChIKey]
APSQWHAHUIGFLU-UHFFFAOYSA-N | [SMILES]
C12SC(C)=C(C)C1=C(Cl)C(C#N)=CN=2 |
| Hazard Information | Back Directory | [Definition]
Ademetionine 1,4-butanedisulfonate consists of S-adenosyl-L-methionine (SAMe) bound to 1,4-butanedisulfonic acid. SAMe is a naturally occurring compound formed from methionine and ATP. SAMe is involved in methyl group transfers, which are essential for various biochemical processes, including the methylation of DNA, proteins, and lipids. |
|
|