| Identification | Back Directory | [Name]
1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid | [Synonyms]
Benzyl-PEG4-acid
BnO-PEG3-CH2CH2COOH
BnO-(CH2CH2O)3-CH2CH2COOH
1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid
1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid(WXPC0056) | [MDL Number]
MFCD31561129 | [MOL File]
127457-64-1.mol |
| Chemical Properties | Back Directory | [Boiling point ]
454.3±40.0 °C(Predicted) | [density ]
1.138±0.06 g/cm3(Predicted) | [form ]
Liquid | [pka]
4.28±0.10(Predicted) | [color ]
Colorless to light yellow |
| Hazard Information | Back Directory | [Description]
Benzyl-PEG4-acid is a PEG linker containing a benzyl protecting group and a carboxylic acid group. Benzyl is an alcohol protecting group and can be removed via hydrogenolysis. The carboxylic acid group can react with primary amine groups in the presence of activators such as EDC or HATU to form a stable amide bond. |
|
| Company Name: |
Wuxi AppTec
|
| Tel: |
022-59987777 13552403979 |
| Website: |
www.labnetwork.com |
|