| Identification | Back Directory | [Name]
2,3,9,10,16,17-Hexachlorinated boron subphthalocyanine chloride | [CAS]
309963-65-3 | [Synonyms]
Cl6SubPc
2,3,9,10,16,17-Hexachlorinated boron subphthalocyanine chloride | [Molecular Formula]
C24H6BCl7N6 | [MOL File]
309963-65-3.mol | [Molecular Weight]
637.31 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C24H6BCl7N6/c26-13-1-7-8(2-14(13)27)20-34-22-11-5-17(30)18(31)6-12(11)24-35-23-10-4-16(29)15(28)3-9(10)21-33-19(7)36(20)25(32,37(21)23)38(22)24/h1-6H | [InChIKey]
NGGZHGSVWBIUJC-UHFFFAOYSA-N | [SMILES]
[Cl-][B+3]12N3=C4C5=CC(Cl)=C(Cl)C=C5C3=NC3=C5C=C(Cl)C(Cl)=CC5=C(N=C5C6=CC(Cl)=C(Cl)C=C6C(=N4)[N-]15)[N-]23 |
| Hazard Information | Back Directory | [Definition]
ChEBI: Nitric acid is a nitrogen oxoacid of formula HNO3 in which the nitrogen atom is bonded to a hydroxy group and by equivalent bonds to the remaining two oxygen atoms. It has a role as a protic solvent and a reagent. It is a conjugate acid of a nitrate. |
|
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
|