| Identification | Back Directory | [Name]
5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid | [CAS]
75113-60-9 | [Synonyms]
5-(2-hydroxyethyl)-4-methyl-2-Thiazolecarboxylic acid
2-Thiazolecarboxylic acid, 5-(2-hydroxyethyl)-4-methyl-
5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid
5-(2-hydroxyethyl)-4-methyl-1,3-thiazole-2-carboxylic acid | [Molecular Formula]
C7H9NO3S | [MOL File]
75113-60-9.mol | [Molecular Weight]
187.22 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C7H9NO3S/c1-4-5(2-3-9)12-6(8-4)7(10)11/h9H,2-3H2,1H3,(H,10,11) | [InChIKey]
LNYKIGXWFDMPNZ-UHFFFAOYSA-N | [SMILES]
S1C(CCO)=C(C)N=C1C(O)=O |
| Hazard Information | Back Directory | [Uses]
5-(beta-hydroxyethyl)-4-methylthiazole-2-carboxylic acid (4-Methyl-5-Hydroxyethylthiazole Phosphate) is a small molecule belonging to the 4,5-disubstituted thiazole class of organic compounds. These compounds contain a substituted thiazole ring only in the 4th and 5th positions. The compound is involved in thiamine metabolism. It condenses 4-methyl-5-(beta-hydroxyethyl)thiazole monophosphate (THZ-P) and 2-methyl-4-amino-5-hydroxymethyl pyrimidine pyrophosphate (HMP-PP) to form thiamine monophosphate (TMP). |
|
|