Melting point: |
50-51 °C |
Boiling point: |
50-52 °C/0.6 mmHg (lit.) |
Density |
0.813 g/mL at 25 °C (lit.) |
refractive index |
n20/D 1.4527(lit.) |
Flash point: |
133 °F |
storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
solubility |
Miscible with organic solvents. |
form |
liquid |
color |
Clear, colourless |
Specific Gravity |
0.813 |
Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
BRN |
3536241 |
InChI |
InChI=1S/C11H22Si/c1-8-12(9(2)3,10(4)5)11(6)7/h1,9-11H,2-7H3 |
InChIKey |
KZGWPHUWNWRTEP-UHFFFAOYSA-N |
SMILES |
[Si](C#C)(C(C)C)(C(C)C)C(C)C |
CAS DataBase Reference |
89343-06-6(CAS DataBase Reference) |