| Melting point: |
-32°C |
| Boiling point: |
55 °C0.3 mm Hg(lit.) |
| Density |
0.934 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.539(lit.) |
| Flash point: |
185 °F |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Liquid |
| pka |
5.77(at 25℃) |
| Specific Gravity |
0.94 |
| color |
Colorless to Orange to Green |
| Water Solubility |
<0.01 g/100 mL at 21 ºC |
| BRN |
2205871 |
| Exposure limits |
ACGIH: TWA 2 ppm (Skin)
NIOSH: IDLH 100 ppm; TWA 2 ppm(10 mg/m3) |
| CAS DataBase Reference |
768-52-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
N-Isopropylaniline(768-52-5) |
| EPA Substance Registry System |
N-Isopropylaniline (768-52-5) |