Melting point: |
69-71 °C(lit.) |
Boiling point: |
215.8°C (rough estimate) |
Density |
1.4921 (rough estimate) |
refractive index |
1.5500 (estimate) |
storage temp. |
2-8°C |
solubility |
Chloroform (Slightly), Methanol (Slightly) |
form |
Crystals or Crystalline Powder |
color |
Off-white to light brown |
Water Solubility |
It is soluble in DMSO, water (partly miscible), most organic solvents, and methanol. |
BRN |
743112 |
InChI |
InChI=1S/C9H9BrO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3 |
InChIKey |
XQJAHBHCLXUGEP-UHFFFAOYSA-N |
SMILES |
C(=O)(C1=CC=C(OC)C=C1)CBr |
CAS DataBase Reference |
2632-13-5(CAS DataBase Reference) |
NIST Chemistry Reference |
Ethanone, 2-bromo-1-(4-methoxyphenyl)-(2632-13-5) |