Melting point: |
-30 °C |
Boiling point: |
201.5 °C |
Density |
0.886 g/mL at 25 °C (lit.) |
refractive index |
n20/D 1.478(lit.) |
Flash point: |
127 °F |
storage temp. |
2-8°C |
solubility |
Chloroform (Slightly), Methanol (Slightly) |
form |
clear liquid |
color |
Colorless to Almost colorless |
Specific Gravity |
0.886 |
Stability: |
Stable. Incompatible with strong oxidizing agents. Flammable. |
InChI |
InChI=1S/C12H20/c1-11-4-9-3-10(5-11)7-12(2,6-9)8-11/h9-10H,3-8H2,1-2H3 |
InChIKey |
CWNOIUTVJRWADX-UHFFFAOYSA-N |
SMILES |
C12(C)CC3CC(CC(C)(C3)C1)C2 |
CAS DataBase Reference |
702-79-4(CAS DataBase Reference) |
NIST Chemistry Reference |
Adamantane, 1,3-dimethyl-(702-79-4) |