Boiling point: |
45-46 °C/0.03 mmHg |
Density |
1.14 g/mL at 25 °C (lit.) |
refractive index |
n20/D 1.415(lit.) |
Flash point: |
213 °F |
storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
solubility |
Miscible with chloroform and ethyl acetate. |
form |
Liquid |
Specific Gravity |
1.14 |
color |
Clear light brown to orange-brown |
Sensitive |
Moisture Sensitive |
Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
BRN |
3591541 |
InChI |
InChI=1S/C10H21F3O3SSi/c1-7(2)18(8(3)4,9(5)6)16-17(14,15)10(11,12)13/h7-9H,1-6H3 |
InChIKey |
LHJCZOXMCGQVDQ-UHFFFAOYSA-N |
SMILES |
C(F)(F)(F)S(O[Si](C(C)C)(C(C)C)C(C)C)(=O)=O |
CAS DataBase Reference |
80522-42-5(CAS DataBase Reference) |