| Boiling point: |
392 °C5 mm Hg |
| Density |
1.2 g/mL at 25 °C(lit.) |
| vapor density |
8.6 (vs air) |
| refractive index |
n20/D 1.634 |
| Flash point: |
>230 °F |
| storage temp. |
Refrigerator, Under inert atmosphere |
| solubility |
DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol (Soluble) |
| form |
Oil |
| color |
Yellow to Orange |
| Stability: |
Stable. Incompatible with strong oxidizing agents, alcohols. May decompose in moist air, or on contact with water. |
| InChI |
InChI=1S/C7H5NO.CH2O/c9-6-8-7-4-2-1-3-5-7;1-2/h1-5H;1H2 |
| InChIKey |
JTEOXXUIKUHXLD-UHFFFAOYSA-N |
| SMILES |
O=C=NC1C([H])=C([H])C([H])=C([H])C=1[H].O=C([H])[H] |
| IARC |
3 (Vol. 19, Sup 7) 1987 |
| EPA Substance Registry System |
Polymeric diphenylmethane diisocyanate (9016-87-9) |