| Melting point: |
19-21°C |
| Boiling point: |
75-77 °C/0.2 mmHg (lit.) |
| Density |
1.22 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.539(lit.) |
| Flash point: |
130 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| Water Solubility |
Slightly miscible with water. |
| BRN |
1424352 |
| InChI |
InChI=1S/C7H12O2S2/c1-2-9-6(8)7-10-4-3-5-11-7/h7H,2-5H2,1H3 |
| InChIKey |
ANEDZEVDORCLPM-UHFFFAOYSA-N |
| SMILES |
S1CCCSC1C(OCC)=O |
| CAS DataBase Reference |
20462-00-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
Ethyl 1,3-dithiane-2-carboxylate(20462-00-4) |