| Melting point: |
122-124 °C(lit.) |
| Boiling point: |
338 °C(lit.) |
| Density |
1.1868 (rough estimate) |
| refractive index |
6.71E-13 (355 nm) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Solubility Insoluble in water; soluble in ethanol |
| form |
Solid |
| pka |
8.04(at 25℃) |
| color |
Light yellow to Brown |
| PH Range |
Non0 uorescence (<9.3) to blue-violet 0 uorescence (9.3) |
| Major Application |
Electroluminescent devices, sensors, plastic scintillation applications, antitumor agent, antibacterial agent |
| InChI |
InChI=1S/C13H9NO2/c15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13/h1-8,15H |
| InChIKey |
GHGZVWOTJDLREY-UHFFFAOYSA-N |
| SMILES |
C1(O)=CC=CC=C1C1=NC2=CC=CC=C2O1 |
| CAS DataBase Reference |
835-64-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenol, 2-(2-benzoxazolyl)- (835-64-3) |