| Melting point: |
170-175 °C |
| alpha |
[α]D20 +11～+13° (c=10, H2O) |
| storage temp. |
Store below +30°C. |
| solubility |
H2O: 0.1 g/mL, clear |
| form |
Crystalline Powder |
| color |
White to light beige |
| PH |
7.0-8.0 (100g/l, H2O, 20℃) |
| Odor |
wh. to ylsh. cryst. powd., pleasant odor |
| Water Solubility |
Very soluble in water; sparingly soluble in alcohol; insoluble in ether. |
| Merck |
14,4456 |
| BRN |
3919651 |
| Stability: |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1/C6H12O7.Na.H/c7-1-2(8)3(9)4(10)5(11)6(12)13;;/h2-5,7-11H,1H2,(H,12,13);;/t2-,3-,4+,5-;;/s3 |
| InChIKey |
MPPJUDJABRMYJR-QZHCVFHNNA-N |
| SMILES |
[C@@H](O)([C@@H](O)C(=O)O)[C@H](O)[C@H](O)CO.[NaH] |&1:0,2,7,9,r| |
| LogP |
-3.175 (est) |
| CAS DataBase Reference |
527-07-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Sodium gluconate (527-07-1) |