| Melting point: |
184°C |
| Boiling point: |
388.54°C (rough estimate) |
| Density |
0.9418 (rough estimate) |
| refractive index |
1.6500 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
5.45±0.10(Predicted) |
| form |
powder to crystal |
| color |
Light yellow to Amber to Dark green |
| InChI |
InChI=1S/C19H13N/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H |
| InChIKey |
MTRFEWTWIPAXLG-UHFFFAOYSA-N |
| SMILES |
C1C2C(=NC3C(C=2C2=CC=CC=C2)=CC=CC=3)C=CC=1 |
| CAS DataBase Reference |
602-56-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Acridine, 9-phenyl-(602-56-2) |
| EPA Substance Registry System |
Acridine, 9-phenyl- (602-56-2) |