| 69029-39-6 Basic information More.. |
Product Name: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether | Synonyms: | Oxirane, methyl-, polymer with oxirane, monobis(1-methylpropyl)phenyl ether;Oxirane, methyl oxirane, bis(1-methylpropyl)phenyl polymer;di(sec-butyl)phenol ethoxylated, propoxylated;Alkylphenol alkoxylate;Ethoxylated propoxylated di-sec-butylphenol;Oxirane polymer with methyloxirane mono[bis(1-methylpropyl)phenyl] ether;PG 26-2;PG 26-3 | CAS: | 69029-39-6 | MF: | C14H22O.(C3H6O)n.(C2H4O)x | MW: | 0 | EINECS: | | Mol File: | Mol File | |
|
69029-39-6 Recommend
Suppliers |
|
|
Recommend You Select Member Companies. |
|
1
|