| | N-Desethyl Isotonitazene Basic information |
| Product Name: | N-Desethyl Isotonitazene | | Synonyms: | 1H-Benzimidazole-1-ethanamine, N-ethyl-2-[[4-(1-methylethoxy)phenyl]methyl]-5-nitro-;N-ethyl-2-[5-nitro-2-[(4-propan-2-yloxyphenyl)methyl]-1-benzimidazolyl]ethanamine;isonitazene;N-ethyl-2-[[4-(1-methylethoxy)phenyl]methyl]-5-nitro-;N-Desethyl Isotonitazene;N-ethyl-2-[5-nitro-2-[(4-propan-2-yloxyphenyl)methyl] | | CAS: | 2732926-24-6 | | MF: | C21H26N4O3 | | MW: | 382.46 | | EINECS: | 200-001-8 | | Product Categories: | 2732926-24-6 | | Mol File: | 2732926-24-6.mol |  |
| | N-Desethyl Isotonitazene Chemical Properties |
| Boiling point | 585.6±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 25 mg/ml DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml DMSO: 20 mg/ml Ethanol: 10 mg/ml | | pka | 9.85±0.19(Predicted) | | form | powder | | color | Yellow | | λmax | 241 nm | | InChI | InChI=1S/C21H26N4O3/c1-4-22-11-12-24-20-10-7-17(25(26)27)14-19(20)23-21(24)13-16-5-8-18(9-6-16)28-15(2)3/h5-10,14-15,22H,4,11-13H2,1-3H3 | | InChIKey | HHBRZWRJZICFRP-UHFFFAOYSA-N | | SMILES | C1(CC2=CC=C(OC(C)C)C=C2)N(CCNCC)C2=CC=C([N+]([O-])=O)C=C2N=1 |
| | N-Desethyl Isotonitazene Usage And Synthesis |
| Description | N-desethyl Etonitazene is an analytical reference standard categorized as an opioid. N-desethyl Etonitazene is a metabolite of etonitazene. This product is intended for research and forensic applications. | | Uses | N-Desethyl Isotonitazene is a useful research chemical compound used in the preparation of benzylbenzimidazole opioids. | | General Description | N-Desethyl Isotonitazene is classified as a novel opioid of the 2-benzyl benzimidazole sub-class and is structurally dissimilar from fentanyl. Novel opioids have been reported to cause psychoactive effects similar to heroin, fentanyl, and other opioids. Novel opioids have also caused adverse events, including death, as described in the literature. | | Pharmacokinetics | N-Desethyl Isotonitazene is a new opioid that is different from fentanyl, but can cause similar effects and adverse events, including death. It was originally a byproduct of isotonitazene, but is now being sold as a separate drug. Its potency is similar to etonitazene and much stronger than fentanyl. Other drugs that are similar in structure include isotonitazene and other nitazene analogues. While it is not explicitly illegal in the US, similar drugs like etonitazene and isotonitazene are classified as Schedule I substances. | | References | 1. Synthesis, chemical characterization, and μ-opioid receptor activity assessment of the emerging group of 'nitazene' 2-benzylbenzimidazole synthetic opioids. DOI: 10.22541/AU.160520665.59016513/V2 2. Isotonitazene Quantitation and Metabolite Discovery in Authentic Forensic Casework. DOI:10.1093/jat/bkaa016 3. Synthesis of analgesically active benzimidazole derivatives with basic substitutions. DOI: 10.1007/BF02161116 4. https://www.cfsre.org/images/monographs/N-Desethyl-Isotonitazene-121922-CFSRE-Chemistry-Report.pdf |
| | N-Desethyl Isotonitazene Preparation Products And Raw materials |
|