|
|
| | (R)-benzyl 2-oxooxetan-3-ylcarbamate Basic information |
| Product Name: | (R)-benzyl 2-oxooxetan-3-ylcarbamate | | Synonyms: | (R)-benzyl 2-oxooxetan-3-ylcarbamate;N-[(3R)-2-Oxo-3-oxetanyl]carbamic acid phenylmethyl ester;N-Carbobenzyloxy-D-serine b-Lactone;N-Carbobenzyloxy-D-serine beta-Lactone;(R)-(2-Oxo-3-oxetanyl)carbamic acid benzyl ester;N-Carbobenzoxy-D-serine β-Lactone;N-Carbobenzyloxy-D-serine-β-lactone;Benzyl [(3R)-2-Oxo-3-oxetanyl]carbamate | | CAS: | 98632-91-8 | | MF: | C11H11NO4 | | MW: | 221.21 | | EINECS: | | | Product Categories: | | | Mol File: | 98632-91-8.mol |  |
| | (R)-benzyl 2-oxooxetan-3-ylcarbamate Chemical Properties |
| Melting point | 131 - 133°C | | Boiling point | 425.5±44.0 °C(Predicted) | | density | 1.31 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Acetone (Slightly), Acetonitrile (Slightly), Chloroform (Slightly) | | form | Solid | | pka | 10.32±0.20(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C11H11NO4/c13-10-9(7-15-10)12-11(14)16-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,14)/t9-/m1/s1 | | InChIKey | CWFZPRQDHIUBDO-SECBINFHSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)N[C@@H]1COC1=O |
| | (R)-benzyl 2-oxooxetan-3-ylcarbamate Usage And Synthesis |
| | (R)-benzyl 2-oxooxetan-3-ylcarbamate Preparation Products And Raw materials |
|