|
| 1-Methylamino-4-bromo anthraquinone Basic information |
Product Name: | 1-Methylamino-4-bromo anthraquinone | Synonyms: | 1-BROMO-4-METHYLAMINO-ANTHRAQUINONE;1-METHYLAMINO-4-BROMO ANTHRAQUINONE;1-bromo-4-(methylamino)-10-anthracenedione;1-bromo-4-(methylamino)-anthraquinon;1-Bromo-4-methylamino-9,10-anthracenedione;4-BROMO-1-(METHYLAMINO)ANTHRAQUINONE;1-Methylamine-4-Bromoanthraquinone;1-methylamino-4-bromanthrachinon | CAS: | 128-93-8 | MF: | C15H10BrNO2 | MW: | 316.15 | EINECS: | 204-920-5 | Product Categories: | Intermediates of Dyes and Pigments | Mol File: | 128-93-8.mol | |
| 1-Methylamino-4-bromo anthraquinone Chemical Properties |
Melting point | 195.5°C | Boiling point | 510.1±50.0 °C(Predicted) | density | 1.5512 (rough estimate) | refractive index | 1.6320 (estimate) | pka | 1.41±0.20(Predicted) | InChI | InChI=1S/C15H10BrNO2/c1-17-11-7-6-10(16)12-13(11)15(19)9-5-3-2-4-8(9)14(12)18/h2-7,17H,1H3 | InChIKey | IIPRUQZTMZETSL-UHFFFAOYSA-N | SMILES | C1(Br)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=C(NC)C=C1 | CAS DataBase Reference | 128-93-8(CAS DataBase Reference) | EPA Substance Registry System | 9,10-Anthracenedione, 1-bromo-4-(methylamino)- (128-93-8) |
| 1-Methylamino-4-bromo anthraquinone Usage And Synthesis |
Safety Profile | An eye irritant. When
heated to decomposition it emits toxic
fumes of NOx and Br |
| 1-Methylamino-4-bromo anthraquinone Preparation Products And Raw materials |
|