| Company Name: |
HBCChem, Inc.
|
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
| Products Intro: |
Product Name:Propargylglycine
CAS:58160-95-5
Purity:99.61% Package:1kg ; 5 kg ; 20kg Remarks:HBC1397
|
|
| | Propargylglycine Basic information |
| Product Name: | Propargylglycine | | Synonyms: | propargylglycine;2-(Prop-2-ynylamino)acetic acid;Acetic acid, 2-(prop-2-ynylamino)-;N-2-propyn-1-ylGlycine;Glycine,N-2-propyn-1-yl- | | CAS: | 58160-95-5 | | MF: | C5H7NO2 | | MW: | 113.11 | | EINECS: | | | Product Categories: | | | Mol File: | 58160-95-5.mol |  |
| | Propargylglycine Chemical Properties |
| Melting point | 243 °C (decomp) | | Boiling point | 273.5±20.0 °C(Predicted) | | density | 1.150±0.06 g/cm3(Predicted) | | pka | 2.18±0.10(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C5H7NO2/c1-2-3-6-4-5(7)8/h1,6H,3-4H2,(H,7,8) | | InChIKey | XSJLQGMTIHCDSS-UHFFFAOYSA-N | | SMILES | C(O)(=O)CNCC#C |
| | Propargylglycine Usage And Synthesis |
| Uses | N-Propargylglycine is an orally active irreversible inhibitor of proline dehydrogenase (PRODH). N-Propargylglycine has antitumor activity and can be used in the study of neurodegenerative diseases[1]. | | References | [1] Scott GK, et al. N-Propargylglycine: a unique suicide inhibitor of proline dehydrogenase with anticancer activity and brain-enhancing mitohormesis properties. Amino Acids. 2021 Dec;53(12):1927-1939. DOI:10.1007/s00726-021-03012-9 |
| | Propargylglycine Preparation Products And Raw materials |
|