|
| 6-METHYL-CHROMAN-4-YLAMINE Basic information |
Product Name: | 6-METHYL-CHROMAN-4-YLAMINE | Synonyms: | 6-METHYL-CHROMAN-4-YLAMINE;2H-1-Benzopyran-4-amine, 3,4-dihydro-6-methyl-;6-methyl-3,4-dihydro-2H-chromen-4-ylamine hydrochloride;3,4-Dihydro-6-methyl-2H-1-benzopyran-4-amine;6-Methyl-3,4-dihydro-2H-chroMen-4-aMine;6-methylchroman-4-amine | CAS: | 638220-39-0 | MF: | C10H13NO | MW: | 163.22 | EINECS: | | Product Categories: | | Mol File: | 638220-39-0.mol | ![6-METHYL-CHROMAN-4-YLAMINE Structure](CAS/GIF/638220-39-0.gif) |
| 6-METHYL-CHROMAN-4-YLAMINE Chemical Properties |
Boiling point | 256℃ | density | 1.079 | Fp | 110℃ | storage temp. | 2-8°C | pka | 8.84±0.20(Predicted) | InChI | InChI=1S/C10H13NO/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-3,6,9H,4-5,11H2,1H3 | InChIKey | LXNRUKZCRQFUCU-UHFFFAOYSA-N | SMILES | C1OC2=CC=C(C)C=C2C(N)C1 |
Hazard Codes | Xn | Risk Statements | 22 |
| 6-METHYL-CHROMAN-4-YLAMINE Usage And Synthesis |
| 6-METHYL-CHROMAN-4-YLAMINE Preparation Products And Raw materials |
|