| | Rilmazafone Hydrochloride Basic information |
| Product Name: | Rilmazafone Hydrochloride | | Synonyms: | Rilmazafone Hydrochloride;5-[[(2-aminoacetyl)amino]methyl]-1-[4-chloro-2-(2-chlorobenzoyl)phenyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide,hydrochloride;Rilmazafone HCl;Rimazapin hydrochloride | | CAS: | 85815-37-8 | | MF: | C21H21Cl3N6O3 | | MW: | 511.79 | | EINECS: | 200-838-9 | | Product Categories: | 85815-37-8 | | Mol File: | 85815-37-8.mol |  |
| | Rilmazafone Hydrochloride Chemical Properties |
| Melting point | >153°C (dec.) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Light Beige | | InChI | InChI=1S/C21H20Cl2N6O3.ClH/c1-28(2)21(32)20-26-17(11-25-18(30)10-24)29(27-20)16-8-7-12(22)9-14(16)19(31)13-5-3-4-6-15(13)23;/h3-9H,10-11,24H2,1-2H3,(H,25,30);1H | | InChIKey | KHINGHZNENOVFD-UHFFFAOYSA-N | | SMILES | C(C1=NC(C(=O)N(C)C)=NN1C1C=CC(Cl)=CC=1C(C1C=CC=CC=1Cl)=O)NC(=O)CN.Cl |
| | Rilmazafone Hydrochloride Usage And Synthesis |
| Description | Rilmazafone is a new hypnotic with anxiolytic properties. The major advantages of
rilmazafone are claimed to be a significant reduction of motor ataxia and the lack of
habituation or hang-over associated with other hypnotics. | | Originator | Shionogi (Japan) | | Uses | Rilmazafone Hydrochloride can be used in biological study of nitrazepam or rilmazafone hydrochloride combined with ethanol effects on human memory. It is also used as sleep aid medication. | | Brand name | Rhythmy |
| | Rilmazafone Hydrochloride Preparation Products And Raw materials |
|