|
|
| | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride Basic information |
| Product Name: | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride | | Synonyms: | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride;(3R,4S,5S)-3-Methoxy-5-methyl-4-(methylamino)heptanoic Acid 1,1-Dimethylethyl Ester Hydrochloride;(3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydrochloride (Dil-HCl);Dolaisoleucine Hydrochloride (DIL-HCl);2-Methyl-2-propanyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino) heptanoate hydrochloride (1:1);3R,4S,5S-tert-butyl 3-methoxy-5-methyl-4-;methylaminoheptanoatehydrochloride;DILTIAZEM HYDROCHLORIDE;CRD401; CRD-401;CRD 401 | | CAS: | 120205-48-3 | | MF: | C14H30ClNO3 | | MW: | 295.85 | | EINECS: | | | Product Categories: | | | Mol File: | 120205-48-3.mol |  |
| | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | color | White to off-white | | InChI | InChI=1/C14H29NO3.ClH/c1-8-10(2)13(15-6)11(17-7)9-12(16)18-14(3,4)5;/h10-11,13,15H,8-9H2,1-7H3;1H/t10-,11+,13-;/s3 | | InChIKey | JRXGCIIOQALIMZ-IPYRWZCONA-N | | SMILES | [C@H](NC)([C@@H](C)CC)[C@H](OC)CC(=O)OC(C)(C)C.Cl |&1:0,3,7,r| | | CAS DataBase Reference | 120205-48-3 |
| | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride Usage And Synthesis |
| Uses | (3R,4S,5S)-3-Methoxy-5-methyl-4-(methylamino)heptanoic Acid 1,1-Dimethylethyl Ester is an β-methoxy-γ-amino acid component of dolastatin 10, an antineoplastic agent. |
| | (3R,4S,5S)-tert-butyl 3-Methoxy-5-Methyl-4-(MethylaMino)heptanoate hydroc hloride Preparation Products And Raw materials |
|