| Company Name: |
Jinan Type Chemical Co., Ltd.
|
| Tel: |
0531-88062576 13791023792 |
| Email: |
sales@typechem.com |
| Products Intro: |
Product Name:AOCBC
CAS:130166-92-6
Purity:99% Package:5g;100g;1kg;25kg
|
| Company Name: |
Hunan chemfish Scientific co.,ltd
|
| Tel: |
0731-85567275 15528049369 |
| Email: |
sales@chemfish.com |
| Products Intro: |
Product Name:4[4[6-Acryloxyhex-1-yl)oxyphenyl]carboxy-biphenyl-4′-carbonitrile
CAS:130166-92-6
Purity:99% HPLC Package:10g
|
|
| | 4[4[6-Acryloxyhex-1-yl)oxyphenyl]carboxy-biphenyl-4′-carbonitrile Basic information |
| | 4[4[6-Acryloxyhex-1-yl)oxyphenyl]carboxy-biphenyl-4′-carbonitrile Chemical Properties |
| Melting point | 110-111 °C | | Boiling point | 649.2±55.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | form | solid | | color | white | | InChI | InChI=1S/C29H27NO5/c1-2-28(31)34-20-6-4-3-5-19-33-26-15-13-25(14-16-26)29(32)35-27-17-11-24(12-18-27)23-9-7-22(21-30)8-10-23/h2,7-18H,1,3-6,19-20H2 | | InChIKey | XJSHMVGXIABVNW-UHFFFAOYSA-N | | SMILES | C(OC1=CC=C(C2=CC=C(C#N)C=C2)C=C1)(=O)C1=CC=C(OCCCCCCOC(=O)C=C)C=C1 |
| | 4[4[6-Acryloxyhex-1-yl)oxyphenyl]carboxy-biphenyl-4′-carbonitrile Usage And Synthesis |
| | 4[4[6-Acryloxyhex-1-yl)oxyphenyl]carboxy-biphenyl-4′-carbonitrile Preparation Products And Raw materials |
|