|
|
| | Methyl 5-formyl-2-hydroxybenzoate Basic information |
| Product Name: | Methyl 5-formyl-2-hydroxybenzoate | | Synonyms: | 5-FORMYL-2-HYDROXYBENZOIC ACID METHYL ESTER;Methyl 5-formyl-2-hydroxybenzoate;5-formylsalicylic acid methyl ester;2-Hydroxy-5-formylbenzoic acid methyl ester;Methyl 5-Formylsalicylate;5-Formylsalicylic Acid Methyl Ester
Methyl 5-Formyl-2-hydroxybenzoate
5-Formyl-2-hydroxybenzoic Acid Methyl Ester;Isophthalaldehydic acid, 6-hydroxy-, methyl ester;Methyl 5-formyl-2-hydroxybenzoate in stock Factory | | CAS: | 41489-76-3 | | MF: | C9H8O4 | | MW: | 180.16 | | EINECS: | 677-591-2 | | Product Categories: | API intermediates;Acids and Derivatives;Carbonyl Compounds | | Mol File: | 41489-76-3.mol |  |
| | Methyl 5-formyl-2-hydroxybenzoate Chemical Properties |
| Melting point | 79.0 to 83.0 °C | | Boiling point | 294.5±25.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 7.57±0.18(Predicted) | | color | White to Light yellow | | InChI | InChI=1S/C9H8O4/c1-13-9(12)7-4-6(5-10)2-3-8(7)11/h2-5,11H,1H3 | | InChIKey | XJKWVPNWHOCFBR-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(C=O)=CC=C1O | | CAS DataBase Reference | 41489-76-3 |
| | Methyl 5-formyl-2-hydroxybenzoate Usage And Synthesis |
| | Methyl 5-formyl-2-hydroxybenzoate Preparation Products And Raw materials |
|