|
Product Name: | NPTPT | Synonyms: | N-(N-Propyl)thiophosphoric triamide;NPPT;NPTPT;Phosphorothioic triamide, N-propyl-;NPTPT ISO 9001:2015 REACH;N-Propylphosphorothioic Triamide | CAS: | 916809-14-8 | MF: | C3H12N3PS | MW: | 153.19 | EINECS: | 618-780-1 | Product Categories: | | Mol File: | 916809-14-8.mol | |
| NPTPT Chemical Properties |
Melting point | 89 - 92°C | Boiling point | 262.1±23.0 °C(Predicted) | density | 1.253 at 20℃ | vapor pressure | 0-0.016Pa at 20-50℃ | storage temp. | Refrigerator, Under inert atmosphere | solubility | Chloroform (Slightly, Heated), Methanol (Slightly, Heated) | form | Solid | pka | 6.27±0.70(Predicted) | color | White to Off-White | LogP | 0.3 at 24℃ |
| NPTPT Usage And Synthesis |
Uses | N-Propylphosphorothioic triamide is used to significantly reduce ammonia volatilization in urea. |
| NPTPT Preparation Products And Raw materials |
|