Company Name: |
ChemStrong Scientific Co.,Ltd
|
Tel: |
0755-0755-66853366 13670046396 |
Email: |
sales@chem-strong.com |
Products Intro: |
Product Name:Urapidil Impurity 36 CAS:140456-02-6 Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
|
| 1,3-Propanediamine, N1-(3-chloropropyl)- Basic information |
Product Name: | 1,3-Propanediamine, N1-(3-chloropropyl)- | Synonyms: | 1,3-Propanediamine, N1-(3-chloropropyl)-;N1-(3-chloropropyl)propane-1,3-diamine;Roxatidine Impurity 28;Urapidil Impurity 27 DiHCl;Urapidil Impurity 62;Pafolacianine Impurity 21;Roxatidine Impurity 12 | CAS: | 140456-02-6 | MF: | C6H15ClN2 | MW: | 150.65 | EINECS: | | Product Categories: | | Mol File: | 140456-02-6.mol | |
| 1,3-Propanediamine, N1-(3-chloropropyl)- Chemical Properties |
Boiling point | 237.4±20.0 °C(Predicted) | density | 0.994±0.06 g/cm3(Predicted) | pka | 10.18±0.10(Predicted) |
| 1,3-Propanediamine, N1-(3-chloropropyl)- Usage And Synthesis |
| 1,3-Propanediamine, N1-(3-chloropropyl)- Preparation Products And Raw materials |
|