|
| Diisopropylethylamine trihydrofluoride Basic information |
Product Name: | Diisopropylethylamine trihydrofluoride | Synonyms: | N,N-DIISOPROPYLETHYLAMINE TRIHYDROFLUORIDE;n-ethyldiisopropylaminetris(hydrofluo-ride);DIISOPROPYLETHYLAMINE TRIHYDROFLUORIDE;Hμnigs base hydrofluoride, N,N-Diisopropylethylamine trihydrofluoride, N,N-Diisopropylethylamine tris(hydrofluoride), N-Ethyldiisopropylamine tris(hydrofluoride);N-Ethyldiisopropylamine trihydrofluoride;N,N-Diisopropylethylamine trihydrofluoride,95%;Diisopropylethylamin;2,5-diMethylhexan-3-aMine trihydrofluoride | CAS: | 131600-43-6 | MF: | C8H20FN | MW: | 149.25 | EINECS: | | Product Categories: | | Mol File: | 131600-43-6.mol | ![Diisopropylethylamine trihydrofluoride Structure](CAS/GIF/131600-43-6.gif) |
| Diisopropylethylamine trihydrofluoride Chemical Properties |
Boiling point | 93 °C | density | 0.965 | Fp | 113 °C | storage temp. | Flammables area | form | Liquid | color | Clear colorless to yellow-brown | InChI | InChI=1S/C8H19N.FH/c1-6-9(7(2)3)8(4)5;/h7-8H,6H2,1-5H3;1H | InChIKey | UQAWLANFHBJLBU-UHFFFAOYSA-N | SMILES | N(CC)(C(C)C)C(C)C.F | CAS DataBase Reference | 131600-43-6 |
| Diisopropylethylamine trihydrofluoride Usage And Synthesis |
Chemical Properties | Clear colorless to yellow-brown liquid | Definition | Diisopropylethylamine trihydrofluoride is the trihydrofluoride salt of N, N-diisopropylethylamine, which acts as the hindered base in amide coupling reactions between a carboxylic acid and a nucleophilic amine. |
| Diisopropylethylamine trihydrofluoride Preparation Products And Raw materials |
|