| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Allopurinol
CAS:291279-53-3
Purity:95%+ Package:1g;10g;100g;1KG;5KG
|
|
| | allopurinol Basic information |
| | allopurinol Chemical Properties |
| InChI | InChI=1S/C5H4N4O/c10-5-3-1-8-9-4(3)6-2-7-5/h1-2H,(H2,6,7,8,9,10) | | InChIKey | OFCNXPDARWKPPY-UHFFFAOYSA-N | | SMILES | O=C1NC=NC2NN=CC1=2 | | CAS DataBase Reference | 291279-53-3 |
| | allopurinol Usage And Synthesis |
| Definition | ChEBI: Allopurinol is a bicyclic structure comprising a pyrazole ring fused to a hydroxy-substituted pyrimidine ring. It has a role as a radical scavenger, a gout suppressant, an antimetabolite and an EC 1.17.3.2 (xanthine oxidase) inhibitor. It is an organic heterobicyclic compound and a nucleobase analogue. It derives from a hydride of a 1H-pyrazolo[4,3-d]pyrimidine. |
| | allopurinol Preparation Products And Raw materials |
|