|
| Cefquinome Basic information |
Product Name: | Cefquinome | Synonyms: | 1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]-5,6,7,8-tetrahydro-quinolinium inner salt;7-[[2-(2-Aminothiazol-4-yl)-2-(methoxyimino)acetyl]amino]-3-[[(5,6,7,8-tetrahydroquinolinium)-1-yl]methyl]cepham-3-ene-4-carboxylate;HR-111V;CefquinomeQ: What is
Cefquinome Q: What is the CAS Number of
Cefquinome Q: What is the storage condition of
Cefquinome;cefquinome;(6R,7R)-7-{[(2Z)-2-(2-Amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-3-(5,6,7,8-tetrahydro-1-quinoliniumylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;Cefquinoxime;Cefotaxime Impurity 58 | CAS: | 84957-30-2 | MF: | C23H24N6O5S2 | MW: | 528.6 | EINECS: | | Product Categories: | | Mol File: | 84957-30-2.mol | ![Cefquinome Structure](CAS/GIF/84957-30-2.gif) |
| Cefquinome Chemical Properties |
Melting point | >160°C (dec.) | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | form | Solid | color | White to Pale Yellow | Stability: | Hygroscopic | InChIKey | YWKJNRNSJKEFMK-YYMYJTJINA-N | SMILES | C(C1=C(CS[C@]2([H])[C@H](NC(=O)/C(/C3=CSC(N)=N3)=N\OC)C(=O)N12)C[N+]1=CC=CC2CCCCC1=2)(=O)[O-] |&1:5,7,r| |
| Cefquinome Usage And Synthesis |
Chemical Properties | White to pale yellow crystalline powder | Uses | Cefquinome (cas# 84957-30-2) is a compound useful in organic synthesis. | Uses | Antibacterial
(veterinary). |
| Cefquinome Preparation Products And Raw materials |
|