|
|
| | 2-Chloro-4,5-difluorobenzoic acid Basic information |
| Product Name: | 2-Chloro-4,5-difluorobenzoic acid | | Synonyms: | RARECHEM AL BO 1000;TIMTEC-BB SBB003616;2-CHLORO-4,5-DIFLUOROBENZOIC ACID;2-CHLORO-4 5-DIFLUOROBENZENE ACID 98%;2-Chloro-4,5-difluorobenzoic acid, 99+%;2-Chloro-4,5-difluorobenzoic acid 99%;2-chloro-4,5-difluorophenyl acid;2-CHLORO-4,5-DIFLUOROBENZOIC ACID,98% | | CAS: | 110877-64-0 | | MF: | C7H3ClF2O2 | | MW: | 192.55 | | EINECS: | 405-380-5 | | Product Categories: | Fluorine series;Benzoic acid;C7;Carbonyl Compounds;Carboxylic Acids;Aromatic compound;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts | | Mol File: | 110877-64-0.mol |  |
| | 2-Chloro-4,5-difluorobenzoic acid Chemical Properties |
| Melting point | 103-106 °C (lit.) | | Boiling point | 258 °C | | density | 1.4821 (estimate) | | Fp | 257-259°C | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.50±0.25(Predicted) | | form | Fine Crystalline Powder | | color | White | | Water Solubility | 5.0 g/L (20 ºC) | | BRN | 4247522 | | InChI | InChI=1S/C7H3ClF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12) | | InChIKey | CGFMLBSNHNWJAW-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(F)C=C1Cl | | CAS DataBase Reference | 110877-64-0(CAS DataBase Reference) |
| | 2-Chloro-4,5-difluorobenzoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | General Description | 2-Chloro-4,5-difluorobenzoic acid is an important intermediate in medicinal compounds and pesticides. Lanthanide complexes with the 2-chloro-4,5-difluorobenzoate (2-cl-4,5-dfba) and 1,10-phenanthroline (phen), have been prepared and their crystal structures have been studied. Efficient synthesis of 2-chloro-4,5-difluorobenzoic acid v-difluororbenzene has been reported. |
| | 2-Chloro-4,5-difluorobenzoic acid Preparation Products And Raw materials |
|