|
| Sertraline EP IMpurity B Basic information |
Product Name: | Sertraline EP IMpurity B | Synonyms: | Sertraline EP IMpurity B;cis-1,2,3,4-Tetrahydro-N-methyl-4-phenyl-1-naphthalenamine hydrochloride;Sertraline hydrochloride Impurity 1;Sertraline Impurity 2(Sertraline EP Impurity B);(1S,4S)-N-Methyl-4-phenyl-1,2,3,4-tetrahydro-1-naphthalenamine hy drochloride (1:1);Sertraline EP Impurity B HCl;(1RS,4RS)-N-Methyl-4-phenyl-1,2,3,4;Sertraline EP Impurity BQ: What is
Sertraline EP Impurity B Q: What is the CAS Number of
Sertraline EP Impurity B Q: What is the storage condition of
Sertraline EP Impurity B Q: What are the applications of
Sertraline EP Impurity B | CAS: | 52758-05-1 | MF: | C17H20ClN | MW: | 273.8 | EINECS: | | Product Categories: | | Mol File: | 52758-05-1.mol |  |
| Sertraline EP IMpurity B Chemical Properties |
solubility | DMSO (Slightly), Methanol (Slightly) | form | Solid | color | White to Off-White | InChI | InChI=1/C17H19N.ClH/c1-18-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17;/h2-10,14,17-18H,11-12H2,1H3;1H/t14-,17-;/s3 | InChIKey | XTSOELQVDLSJFM-ZXIWTAKENA-N | SMILES | N([C@H]1CC[C@@H](C2C=CC=CC=2)C2=CC=CC=C12)C.Cl |&1:1,4,r| |
| Sertraline EP IMpurity B Usage And Synthesis |
Uses | rac-cis-3,4-Deschlorosertraline (Sertraline EP Impurity B) is a derivative of the antidepressant compound Sertraline (S280000). It has also been studied for effects on uptake of norephinephrine. |
| Sertraline EP IMpurity B Preparation Products And Raw materials |
|