|
|
| | tert-butyl 4-chloro-3-fluorophenylcarbaMate Basic information |
| Product Name: | tert-butyl 4-chloro-3-fluorophenylcarbaMate | | Synonyms: | tert-butyl 4-chloro-3-fluorophenylcarbaMate;1,1-Dimethylethyl (4-chloro-3-fluorophenyl)carbamate;(4-Chloro-3-fluoro-phenyl)-carbamic acid tert-butyl ester;N-Boc-4-chloro-3-fluoroaniline;110318;Carbamic acid, N-(4-chloro-3-fluorophenyl)-, 1,1-dimethylethyl ester;tert-butyl hydrogen (E)-(4-chloro-3-fluorophenyl)carbonimidate;tert-butyl N-(4-chloro-3-fluorophenyl)carbamate | | CAS: | 869299-68-3 | | MF: | C11H13ClFNO2 | | MW: | 245.68 | | EINECS: | | | Product Categories: | | | Mol File: | 869299-68-3.mol |  |
| | tert-butyl 4-chloro-3-fluorophenylcarbaMate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature |
| | tert-butyl 4-chloro-3-fluorophenylcarbaMate Usage And Synthesis |
| | tert-butyl 4-chloro-3-fluorophenylcarbaMate Preparation Products And Raw materials |
|