|
| 7-TETRADECANOL Basic information |
Product Name: | 7-TETRADECANOL | Synonyms: | 7-TETRADECANOL 99%;1-Hexyl-1-octanol;7-TETRADECANOL;7-Tetradecanol,99%;tetradecan-7-ol | CAS: | 3981-79-1 | MF: | C14H30O | MW: | 214.39 | EINECS: | | Product Categories: | | Mol File: | 3981-79-1.mol | ![7-TETRADECANOL Structure](CAS/GIF/3981-79-1.gif) |
| 7-TETRADECANOL Chemical Properties |
Melting point | 42 °C | Boiling point | 156 °C / 14mmHg | density | 0.8097 (estimate) | refractive index | 1.4237 (estimate) | pka | 15.47±0.20(Predicted) | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C14H30O/c1-3-5-7-9-11-13-14(15)12-10-8-6-4-2/h14-15H,3-13H2,1-2H3 | InChIKey | FFAQYGTZIMVBFJ-UHFFFAOYSA-N | SMILES | CCCCCCC(O)CCCCCCC | CAS DataBase Reference | 3981-79-1 |
| 7-TETRADECANOL Usage And Synthesis |
| 7-TETRADECANOL Preparation Products And Raw materials |
|