|
|
| | Mc-Val-Ala-PAB-PNP Basic information |
| Product Name: | Mc-Val-Ala-PAB-PNP | | Synonyms: | Mc-Val-Ala-PAB-PNP;L-Alaninamide, N-[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxohexyl]-L-valyl-N-[4-[[[(4-nitrophenoxy)carbonyl]oxy]methyl]phenyl]-;4-((S)-2-((S)-2-(6-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)hexanamido)-3-methylbutanamido)propanamido)benzyl (4-nitrophenyl) carbonate;inhibit,ADC Linkers,Inhibitor,MC Val Ala PAB PNP,Antibody-drug conjugates linkers,MCValAlaPABPNP | | CAS: | 1639939-40-4 | | MF: | C32H37N5O10 | | MW: | 651.66 | | EINECS: | | | Product Categories: | Linker;ADC LINKER | | Mol File: | 1639939-40-4.mol |  |
| | Mc-Val-Ala-PAB-PNP Chemical Properties |
| Boiling point | 946.4±65.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | pka | 13.31±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | VMOQJVBAOUFRSX-LGGPFLRQSA-N | | SMILES | C(N)(=O)[C@H](C)N(C(=O)[C@H](C(C)C)NC(=O)CCCCCN1C(=O)C=CC1=O)C1=CC=C(COC(OC2=CC=C([N+]([O-])=O)C=C2)=O)C=C1 |
| | Mc-Val-Ala-PAB-PNP Usage And Synthesis |
| Biological Activity | MC-Val-Ala-PAB-PNP is a cleavable ADC linker that can be used to synthesize antibody-drug conjugates (ADCs). | | in vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. | | target | |
| | Mc-Val-Ala-PAB-PNP Preparation Products And Raw materials |
|