|
| m-tolyl adamantane-1-carboxylate Basic information |
Product Name: | m-tolyl adamantane-1-carboxylate | Synonyms: | m-tolyl adamantane-1-carboxylate;Tricyclo[3.3.1.13,7]decane-1-carboxylic acid, 3-methylphenyl ester;(3-methylphenyl) adamantane-1-carboxylate;3-methylphenyltricyclo[3.3.1.1~3,7~]decane-1-carboxylate | CAS: | 73599-99-2 | MF: | C18H22O2 | MW: | 270.37 | EINECS: | | Product Categories: | | Mol File: | 73599-99-2.mol | ![m-tolyl adamantane-1-carboxylate Structure](CAS/20200331/GIF/73599-99-2.gif) |
| m-tolyl adamantane-1-carboxylate Chemical Properties |
Boiling point | 376.5±11.0 °C(Predicted) | density | 1.157±0.06 g/cm3(Predicted) | InChI | InChI=1S/C18H22O2/c1-12-3-2-4-16(5-12)20-17(19)18-9-13-6-14(10-18)8-15(7-13)11-18/h2-5,13-15H,6-11H2,1H3 | InChIKey | DYVRJWFCGLMSCP-UHFFFAOYSA-N | SMILES | C12(C(OC3=CC=CC(C)=C3)=O)CC3CC(CC(C3)C1)C2 |
| m-tolyl adamantane-1-carboxylate Usage And Synthesis |
| m-tolyl adamantane-1-carboxylate Preparation Products And Raw materials |
|