| Company Name: |
ChemStrong Scientific Co.,Ltd
|
| Tel: |
0755-0755-66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:P-SCN-Bn-Deferoxamine
CAS:1222468-90-7
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Changzhou Hopschain Chemical Co.,Ltd.
|
| Tel: |
0519-85528066 13775048983 |
| Email: |
sales@hopschem.com |
| Products Intro: |
Product Name:p-NCS-Bz-DFO
CAS:1222468-90-7
Purity:95+% Package:50mg;100mg;500mg
|
| Company Name: |
Shanghai Pingguo Pharmaceutical Co., Ltd.
|
| Tel: |
021-20432229 |
| Email: |
2412110556@qq.com |
| Products Intro: |
Product Name:2-[1, 4, 7-Triazacyclononan-1-yl-4, 7-bis(tBu-ester)1-1, 5-pentanedioic acid
CAS:1222468-90-7
Purity:94% Package:5G Remarks:instock Micro
|
| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd.
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:p-SCN-Bn-Deferoxamine
CAS:1222468-90-7
Purity:95% HPLC Package:10MG;25MG;50MG;100MG;1G;5G Remarks:For customers outside China,please use the website:www.confluore.com
|
p-NCS-Bz-DFO manufacturers
- p-SCN-Bn-Deferoxamine
-
- $0.00 / 50mg
-
2024-04-02
- CAS:1222468-90-7
- Min. Order: 50mg
- Purity: >95.00%
- Supply Ability: 50mg
|
| | p-NCS-Bz-DFO Basic information |
| Product Name: | p-NCS-Bz-DFO | | Synonyms: | p-NCS-Bz-DFO;2-[1, 4, 7-Triazacyclononan-1-yl-4, 7-bis(tBu-ester)1-1, 5-pentanedioic acid;p-SCN-Bn-Deferoxamine;Butanediamide, N4-[5-[[4-[[5-(acetylhydroxyamino)pentyl]amino]-1,4-dioxobutyl]hydroxyamino]pentyl]-N1-hydroxy-N1-[5-[[[(4-isothiocyanatophenyl)amino]thioxomethyl]amino]pentyl]-;p-SCN-Bn-Deferoxamine,p-NCS-Bz-DFO;p-SCN-Bz-DFO | | CAS: | 1222468-90-7 | | MF: | C33H52N8O8S2 | | MW: | 752.94 | | EINECS: | | | Product Categories: | | | Mol File: | 1222468-90-7.mol |  |
| | p-NCS-Bz-DFO Chemical Properties |
| Melting point | 174° - 175° | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Acetonitrile (Slightly, Heated), DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChIKey | HBAYEVATSBINBX-UHFFFAOYSA-N | | SMILES | C(N(O)CCCCCNC(NC1=CC=C(N=C=S)C=C1)=S)(=O)CCC(NCCCCCN(C(=O)CCC(NCCCCCN(C(C)=O)O)=O)O)=O |
| | p-NCS-Bz-DFO Usage And Synthesis |
| Uses | p-SCN-Bn-deferoxamine, is a bifunctional chelator. |
| | p-NCS-Bz-DFO Preparation Products And Raw materials |
|