2,1,3-benzoselenadiazole manufacturers
|
| 2,1,3-benzoselenadiazole Basic information |
Product Name: | 2,1,3-benzoselenadiazole | Synonyms: | 2-Selena-1,3-diaza-2H-isoindene;3,4-Benzo-1,2,5-selenadiazole;Phenylpiazselenole;Piazselenol;Piazselenole;2,1,3-Benzoselenadiazole >2,1,3-Benzosenidazole | CAS: | 273-15-4 | MF: | C6H4N2Se | MW: | 183.07 | EINECS: | 205-986-8 | Product Categories: | benzo[c][1,2,5]selenadiazole | Mol File: | 273-15-4.mol | |
| 2,1,3-benzoselenadiazole Chemical Properties |
Melting point | 74-77 °C(lit.) | Boiling point | 246°C(lit.) | pka | 0.51±0.33(Predicted) | form | powder to crystal | color | Light yellow to Brown to Dark green | InChI | InChI=1S/C6H4N2Se/c1-2-4-6-5(3-1)7-9-8-6/h1-4H | InChIKey | AYTPIVIDHMVGSX-UHFFFAOYSA-N | SMILES | N1=C2C=CC=CC2=N[Se]1 |
| 2,1,3-benzoselenadiazole Usage And Synthesis |
| 2,1,3-benzoselenadiazole Preparation Products And Raw materials |
|