| Company Name: |
Zhengzhou Huiju Chemical Co., Ltd.
|
| Tel: |
0371-55900031 18137872243 |
| Email: |
2853979815@qq.com |
| Products Intro: |
Product Name:3-Chloropropyl trifluoromethanesulfonate
CAS:122876-21-5
Purity:98% Package:100mg ；500mg ；1g ；5g ；10g ；25g ；50g ；100g ；250g ；500g ；1kg ；5kg ；25kg
|
| Company Name: |
Hubei Chuchang Chemical Co., Ltd
|
| Tel: |
15623560702 |
| Email: |
Joy.Ren@aliyun.com |
| Products Intro: |
Product Name:3-Chloropropyl trifluoromethanesulfonate
CAS:122876-21-5
Purity:95+ Package:10mg/g/RMB 800;50mg/g
|
|
| | Methanesulfonic acid, 1,1,1-trifluoro-, 3-chloropropyl ester Basic information |
| | Methanesulfonic acid, 1,1,1-trifluoro-, 3-chloropropyl ester Chemical Properties |
| Boiling point | 50 °C(Press: 0.2 Torr) | | density | 1.513±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C4H6ClF3O3S/c5-2-1-3-11-12(9,10)4(6,7)8/h1-3H2 | | InChIKey | IPSFHFDFHFCBCD-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)S(OCCCCl)(=O)=O |
| | Methanesulfonic acid, 1,1,1-trifluoro-, 3-chloropropyl ester Usage And Synthesis |
| | Methanesulfonic acid, 1,1,1-trifluoro-, 3-chloropropyl ester Preparation Products And Raw materials |
|