| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-85563444 15850508050 |
| Email: |
purchase@synzest.com |
| Products Intro: |
Product Name:2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]-
CAS:191089-80-2
Purity:95% Package:1g;5g;10g
|
| Company Name: |
Combi-Blocks Inc.
|
| Tel: |
858 635 8950 |
| Email: |
sales@combi-blocks.com |
| Products Intro: |
Product Name:3-[(3-Fluorophenyl)amino]cyclohex-2-en-1-one
CAS:191089-80-2
|
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
| Products Intro: |
Product Name:3-[(3-Fluorophenyl)amino]cyclohex-2-en-1-one
CAS:191089-80-2
Package:$300.00/500mg
|
| Company Name: |
Syntechem Co.,Ltd
|
| Tel: |
|
| Email: |
- |
| Products Intro: |
Product Name:3-[(3-fluorophenyl)amino]cyclohex-2-en-1-one
|
| Company Name: |
MolMall Sarl
|
| Tel: |
+41 21 802 18 34 |
| Email: |
info@molmall.net |
| Products Intro: |
Product Name:3-(3-fluoroanilino)cyclohex-2-en-1-one
CAS:191089-80-2
Purity:>90% Package:10mg
|
|
| | 2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- Basic information |
| Product Name: | 2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- | | Synonyms: | 3-[(3-fluorophenyl)amino]cyclohex-2-en-1-one;3-[(3-fluorophenyl)amino]-1-cyclohex-2-enone;InChI=1/C12H12FNO/c13-9-3-1-4-10(7-9)14-11-5-2-6-12(15)8-11/h1,3-4,7-8,14H,2,5-6H;ST5427877;ZINC04265247;2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]-;3-(3-fluoroanilino)cyclohex-2-en-1-one | | CAS: | 191089-80-2 | | MF: | C12H12FNO | | MW: | 205.23 | | EINECS: | | | Product Categories: | | | Mol File: | 191089-80-2.mol | ![2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- Structure](CAS/20140525/GIF/CB22486187.gif) |
| | 2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- Chemical Properties |
| Boiling point | 318.7±42.0 °C(Predicted) | | density | 1.256±0.06 g/cm3(Predicted) | | pka | -0.35±0.20(Predicted) |
| | 2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- Usage And Synthesis |
| | 2-cyclohexen-1-one, 3-[(3-fluorophenyl)amino]- Preparation Products And Raw materials |
|