|
| 3-Bromo-5-chlorophenylboronic acid Basic information |
Product Name: | 3-Bromo-5-chlorophenylboronic acid | Synonyms: | 3-Bromo-5-chlorophenylboronic acid;BORONIC ACID, B-(3-BROMO-5-CHLOROPHENYL)-;B-(3-Bromo-5-chlorophenyl)boronic acid;3-Bromo-5-chlorophenylboronic acid 97%;3-Bromo-5-chlorophenylboronic acid(contains varying amounts of Anhydride) | CAS: | 1186403-17-7 | MF: | C6H5BBrClO2 | MW: | 235.27 | EINECS: | | Product Categories: | | Mol File: | 1186403-17-7.mol | ![3-Bromo-5-chlorophenylboronic acid Structure](CAS2/GIF/1186403-17-7.gif) |
| 3-Bromo-5-chlorophenylboronic acid Chemical Properties |
Boiling point | 367.0±52.0 °C(Predicted) | density | 1.79 | storage temp. | Inert atmosphere,2-8°C | pka | 6.58±0.10(Predicted) |
| 3-Bromo-5-chlorophenylboronic acid Usage And Synthesis |
Uses | 3-Bromo-5-chlorophenylboronic Acid is a reagent used to prepare for a series of indole amidines as inhibitor of acid-sensing ion channel-3 (ASIC3) for the treatment of chronic pain. |
| 3-Bromo-5-chlorophenylboronic acid Preparation Products And Raw materials |
|