|
| Trofinetide Basic information |
Product Name: | Trofinetide | Synonyms: | Trofinetide(NNZ2566);TROFINETIDE; NNZ2566 ;NNZ 2566; NNZ-2566;NNZ-2566;L-Glutamic acid, glycyl-2-methyl-L-prolyl-;Trofinetide;Trofinetide,NNZ 2566,NNZ2566,Inhibitor,inhibit;Glutamic acid, glycyl-;prolyl- | CAS: | 853400-76-7 | MF: | C13H21N3O6 | MW: | 315.32 | EINECS: | | Product Categories: | API | Mol File: | 853400-76-7.mol | ![Trofinetide Structure](CAS/20200611/GIF/853400-76-7.gif) |
| Trofinetide Chemical Properties |
Melting point | 144 °C | Boiling point | 655.4±55.0 °C(Predicted) | density | 1.377±0.06 g/cm3(Predicted) | storage temp. | Store at -20°C | solubility | Methanol (Slightly), Water (Slightly) | form | Solid | pka | 3.51±0.10(Predicted) | color | White to Off-White | Stability: | Hygroscopic | InChI | InChI=1S/C13H21N3O6/c1-13(5-2-6-16(13)9(17)7-14)12(22)15-8(11(20)21)3-4-10(18)19/h8H,2-7,14H2,1H3,(H,15,22)(H,18,19)(H,20,21)/t8-,13-/m0/s1 | InChIKey | BUSXWGRAOZQTEY-SDBXPKJASA-N | SMILES | C(O)(=O)[C@H](CCC(O)=O)NC(=O)[C@]1(C)CCCN1C(=O)CN |
| Trofinetide Usage And Synthesis |
Uses | Trofinetide is a synthetic analogue of the endogenous N-terminus tripeptide, Glycine-Proline-Glutamate (GPE), that has shown to be neuroprotective in animal models of brain injury. |
| Trofinetide Preparation Products And Raw materials |
|